C23H36IN5O2S — CID 111837815
1-ethyl-3-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111837815) has the molecular formula C23H36IN5O2S and a molecular weight of 573.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111837815 |
| Molecular Formula | C23H36IN5O2S |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 1-ethyl-3-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(C(C)C)n1)NCC(c1ccc(OC)cc1)N1CCOCC1.I |
| InChI | InChI=1S/C23H35N5O2S.HI/c1-5-24-23(25-14-19-16-31-22(27-19)17(2)3)26-15-21(28-10-12-30-13-11-28)18-6-8-20(29-4)9-7-18;/h6-9,16-17,21H,5,10-15H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | PQHHJONIDHFJLA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|