C20H30N6O3 — CID 111309564
1-ethyl-3-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine (PubChem CID 111309564) has the molecular formula C20H30N6O3 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111309564 |
| Molecular Formula | C20H30N6O3 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 1-ethyl-3-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C)no1)NCC(c1ccc(OC)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H30N6O3/c1-4-21-20(23-14-19-24-15(2)25-29-19)22-13-18(26-9-11-28-12-10-26)16-5-7-17(27-3)8-6-16/h5-8,18H,4,9-14H2,1-3H3,(H2,21,22,23) |
| InChIKey | SRKDGVFZCGXHMK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|