C19H29IN6O3 — CID 111309423
1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111309423) has the molecular formula C19H29IN6O3 and a molecular weight of 516.38 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111309423 |
| Molecular Formula | C19H29IN6O3 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)no1)NCC(c1ccc(OC)cc1)N1CCOCC1.I |
| InChI | InChI=1S/C19H28N6O3.HI/c1-14-23-18(28-24-14)13-22-19(20-2)21-12-17(25-8-10-27-11-9-25)15-4-6-16(26-3)7-5-15;/h4-7,17H,8-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | MFLPKYPKDWWENM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|