C18H30IN7OS — CID 111284660
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111284660) has the molecular formula C18H30IN7OS and a molecular weight of 519.46 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111284660 |
| Molecular Formula | C18H30IN7OS |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C18H29N7OS.HI/c1-4-19-18(21-13-17-23-22-14(2)24(17)3)20-12-15(16-6-5-11-27-16)25-7-9-26-10-8-25;/h5-6,11,15H,4,7-10,12-13H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | BFSAUHTVUITPON-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|