C19H27ClIN5OS — CID 111284742
2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111284742) has the molecular formula C19H27ClIN5OS and a molecular weight of 535.88 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111284742 |
| Molecular Formula | C19H27ClIN5OS |
| Molecular Weight | 535.88 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-ethyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C19H26ClN5OS.HI/c1-2-21-19(23-13-15-5-6-18(20)22-12-15)24-14-16(17-4-3-11-27-17)25-7-9-26-10-8-25;/h3-6,11-12,16H,2,7-10,13-14H2,1H3,(H2,21,23,24);1H |
| InChIKey | QDFVZAKAKPTAQQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.88 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|