C22H37N7S — CID 111323606
1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine (PubChem CID 111323606) has the molecular formula C22H37N7S and a molecular weight of 431.65 g/mol. Its IUPAC name is 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine.
| Compound Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine |
|---|---|
| PubChem CID | 111323606 |
| Molecular Formula | C22H37N7S |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)NCC(c1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C22H37N7S/c1-5-6-11-23-22(25-16-21-27-26-18(3)28(21)4)24-15-19(20-8-7-14-30-20)29-12-9-17(2)10-13-29/h7-8,14,17,19H,5-6,9-13,15-16H2,1-4H3,(H2,23,24,25) |
| InChIKey | RDYRLOSSBQMSEL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|