C20H31N5S2 — CID 111323230
1-ethyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine (PubChem CID 111323230) has the molecular formula C20H31N5S2 and a molecular weight of 405.64 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111323230 |
| Molecular Formula | C20H31N5S2 |
| Molecular Weight | 405.64 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-ethyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cnc(C)s1)NCC(c1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C20H31N5S2/c1-4-21-20(23-13-17-12-22-16(3)27-17)24-14-18(19-6-5-11-26-19)25-9-7-15(2)8-10-25/h5-6,11-12,15,18H,4,7-10,13-14H2,1-3H3,(H2,21,23,24) |
| InChIKey | CAJXTROCVKCLKC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|