C21H38IN5OS — CID 111323291
N-tert-butyl-2-[[ethylamino-[[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111323291) has the molecular formula C21H38IN5OS and a molecular weight of 535.54 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111323291 |
| Molecular Formula | C21H38IN5OS |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC(c1cccs1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C21H37N5OS.HI/c1-6-22-20(24-15-19(27)25-21(3,4)5)23-14-17(18-8-7-13-28-18)26-11-9-16(2)10-12-26;/h7-8,13,16-17H,6,9-12,14-15H2,1-5H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | HDOKUHYOXWHXPH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|