C20H34IN5OS — CID 111323467
N,N-dimethyl-2-[[[[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111323467) has the molecular formula C20H34IN5OS and a molecular weight of 519.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111323467 |
| Molecular Formula | C20H34IN5OS |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N,N-dimethyl-2-[[[[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NCC(c1cccs1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C20H33N5OS.HI/c1-5-10-21-20(23-15-19(26)24(3)4)22-14-17(18-7-6-13-27-18)25-11-8-16(2)9-12-25;/h5-7,13,16-17H,1,8-12,14-15H2,2-4H3,(H2,21,22,23);1H |
| InChIKey | SRQPUXIDVHTEEH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|