C21H31N5OS2 — CID 111860202
N,N-dimethyl-2-[[[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide (PubChem CID 111860202) has the molecular formula C21H31N5OS2 and a molecular weight of 433.65 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111860202 |
| Molecular Formula | C21H31N5OS2 |
| Molecular Weight | 433.65 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N,N-dimethyl-2-[[[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C21H31N5OS2/c1-25(2)20(27)16-24-21(22-10-9-17-7-5-13-28-17)23-15-18(19-8-6-14-29-19)26-11-3-4-12-26/h5-8,13-14,18H,3-4,9-12,15-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | PLMPOMSUCHRKIL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|