C15H25IN4OS — CID 111492931
N,N-dimethyl-2-[[pyrrolidin-1-yl-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111492931) has the molecular formula C15H25IN4OS and a molecular weight of 436.36 g/mol. Its IUPAC name is N,N-dimethyl-2-[[pyrrolidin-1-yl-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[pyrrolidin-1-yl-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111492931 |
| Molecular Formula | C15H25IN4OS |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N,N-dimethyl-2-[[pyrrolidin-1-yl-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C15H24N4OS.HI/c1-18(2)14(20)12-17-15(19-9-3-4-10-19)16-8-7-13-6-5-11-21-13;/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,16,17);1H |
| InChIKey | OECKJVNYINPPHM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|