C19H33IN4OS — CID 110041407
N,N-dimethyl-2-[[[3-(2-methylpropyl)pyrrolidin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110041407) has the molecular formula C19H33IN4OS and a molecular weight of 492.47 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(2-methylpropyl)pyrrolidin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[3-(2-methylpropyl)pyrrolidin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110041407 |
| Molecular Formula | C19H33IN4OS |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(2-methylpropyl)pyrrolidin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(C)CC1CCN(/C(=N/CC(=O)N(C)C)NCCc2cccs2)C1.I |
| InChI | InChI=1S/C19H32N4OS.HI/c1-15(2)12-16-8-10-23(14-16)19(21-13-18(24)22(3)4)20-9-7-17-6-5-11-25-17;/h5-6,11,15-16H,7-10,12-14H2,1-4H3,(H,20,21);1H |
| InChIKey | PDQFNBJEKFNWGP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|