C17H32N4O — CID 111734965
N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[3-(2-methylpropyl)pyrrolidin-1-yl]methylidene]amino]acetamide (PubChem CID 111734965) has the molecular formula C17H32N4O and a molecular weight of 308.47 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[3-(2-methylpropyl)pyrrolidin-1-yl]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[3-(2-methylpropyl)pyrrolidin-1-yl]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111734965 |
| Molecular Formula | C17H32N4O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[3-(2-methylpropyl)pyrrolidin-1-yl]methylidene]amino]acetamide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)N1CCC(CC(C)C)C1 |
| InChI | InChI=1S/C17H32N4O/c1-13(2)9-15-7-8-21(12-15)17(18-10-14(3)4)19-11-16(22)20(5)6/h13,15H,3,7-12H2,1-2,4-6H3,(H,18,19) |
| InChIKey | AIDIPQPCAGRDLU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|