C18H33N5O3 — CID 111731025
tert-butyl N-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylprop-2-enyl)carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111731025) has the molecular formula C18H33N5O3 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylprop-2-enyl)carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylprop-2-enyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111731025 |
| Molecular Formula | C18H33N5O3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | tert-butyl N-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylprop-2-enyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H33N5O3/c1-13(2)10-19-16(20-11-15(24)22(6)7)23-9-8-14(12-23)21-17(25)26-18(3,4)5/h14H,1,8-12H2,2-7H3,(H,19,20)(H,21,25) |
| InChIKey | XNISZKJPJOJUHY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|