C21H38IN5O3 — CID 110040340
tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide (PubChem CID 110040340) has the molecular formula C21H38IN5O3 and a molecular weight of 535.47 g/mol. Its IUPAC name is tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110040340 |
| Molecular Formula | C21H38IN5O3 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)NC1CC2CCC(C1)N2C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C21H37N5O3.HI/c1-14(2)12-22-19(23-13-18(27)25(6)7)24-15-10-16-8-9-17(11-15)26(16)20(28)29-21(3,4)5;/h15-17H,1,8-13H2,2-7H3,(H2,22,23,24);1H |
| InChIKey | YTEKRZMGPJJOOK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|