C23H41N5O3 — CID 110040345
tert-butyl 3-[[N-cyclohexyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 110040345) has the molecular formula C23H41N5O3 and a molecular weight of 435.61 g/mol. Its IUPAC name is tert-butyl 3-[[N-cyclohexyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[[N-cyclohexyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 110040345 |
| Molecular Formula | C23H41N5O3 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | tert-butyl 3-[[N-cyclohexyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CN(C)C(=O)C/N=C(/NC1CCCCC1)NC1CC2CCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H41N5O3/c1-23(2,3)31-22(30)28-18-11-12-19(28)14-17(13-18)26-21(24-15-20(29)27(4)5)25-16-9-7-6-8-10-16/h16-19H,6-15H2,1-5H3,(H2,24,25,26) |
| InChIKey | CSYQBIFTIIJTJP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|