C23H43N5O3 — CID 110040589
tert-butyl N-[4-[[N-(cyclohexylmethyl)-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]cyclohexyl]carbamate (PubChem CID 110040589) has the molecular formula C23H43N5O3 and a molecular weight of 437.63 g/mol. Its IUPAC name is tert-butyl N-[4-[[N-(cyclohexylmethyl)-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[N-(cyclohexylmethyl)-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 110040589 |
| Molecular Formula | C23H43N5O3 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.34 |
| IUPAC Name | tert-butyl N-[4-[[N-(cyclohexylmethyl)-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]cyclohexyl]carbamate |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCC1)NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H43N5O3/c1-23(2,3)31-22(30)27-19-13-11-18(12-14-19)26-21(25-16-20(29)28(4)5)24-15-17-9-7-6-8-10-17/h17-19H,6-16H2,1-5H3,(H,27,30)(H2,24,25,26) |
| InChIKey | NRGZIGMIEZBCQI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|