C21H35N7O — CID 110039155
2-[[(cyclohexylmethylamino)-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110039155) has the molecular formula C21H35N7O and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-[[(cyclohexylmethylamino)-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclohexylmethylamino)-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110039155 |
| Molecular Formula | C21H35N7O |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | 2-[[(cyclohexylmethylamino)-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCC1)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H35N7O/c1-27(2)19(29)16-25-20(24-15-17-7-4-3-5-8-17)26-18-9-13-28(14-10-18)21-22-11-6-12-23-21/h6,11-12,17-18H,3-5,7-10,13-16H2,1-2H3,(H2,24,25,26) |
| InChIKey | WUPFKMKGJJWNKX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|