C24H33N7O — CID 110039141
N,N-dimethyl-2-[[[(1-pyrimidin-2-ylpiperidin-4-yl)amino]-(1,2,3,4-tetrahydronaphthalen-2-ylamino)methylidene]amino]acetamide (PubChem CID 110039141) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(1-pyrimidin-2-ylpiperidin-4-yl)amino]-(1,2,3,4-tetrahydronaphthalen-2-ylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[(1-pyrimidin-2-ylpiperidin-4-yl)amino]-(1,2,3,4-tetrahydronaphthalen-2-ylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110039141 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | N,N-dimethyl-2-[[[(1-pyrimidin-2-ylpiperidin-4-yl)amino]-(1,2,3,4-tetrahydronaphthalen-2-ylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NC1CCN(c2ncccn2)CC1)NC1CCc2ccccc2C1 |
| InChI | InChI=1S/C24H33N7O/c1-30(2)22(32)17-27-23(29-21-9-8-18-6-3-4-7-19(18)16-21)28-20-10-14-31(15-11-20)24-25-12-5-13-26-24/h3-7,12-13,20-21H,8-11,14-17H2,1-2H3,(H2,27,28,29) |
| InChIKey | IBBHPHAHAKAONN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|