C23H38IN5O3 — CID 110045390
tert-butyl N-[4-[2-[[N-cyclopentyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]ethyl]phenyl]carbamate;hydroiodide (PubChem CID 110045390) has the molecular formula C23H38IN5O3 and a molecular weight of 559.49 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[[N-cyclopentyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]ethyl]phenyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[4-[2-[[N-cyclopentyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]ethyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110045390 |
| Molecular Formula | C23H38IN5O3 |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | tert-butyl N-[4-[2-[[N-cyclopentyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]ethyl]phenyl]carbamate;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1ccc(NC(=O)OC(C)(C)C)cc1)NC1CCCC1.I |
| InChI | InChI=1S/C23H37N5O3.HI/c1-23(2,3)31-22(30)27-19-12-10-17(11-13-19)14-15-24-21(25-16-20(29)28(4)5)26-18-8-6-7-9-18;/h10-13,18H,6-9,14-16H2,1-5H3,(H,27,30)(H2,24,25,26);1H |
| InChIKey | QFURVPVLFSTQDY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|