C17H34IN5O3 — CID 110039766
tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 110039766) has the molecular formula C17H34IN5O3 and a molecular weight of 483.40 g/mol. Its IUPAC name is tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110039766 |
| Molecular Formula | C17H34IN5O3 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NC1CCCN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C17H33N5O3.HI/c1-7-18-15(19-11-14(23)21(5)6)20-13-9-8-10-22(12-13)16(24)25-17(2,3)4;/h13H,7-12H2,1-6H3,(H2,18,19,20);1H |
| InChIKey | JQNQWVFYGDETEH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|