C17H33N5O4 — CID 110048963
tert-butyl (4S)-3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate (PubChem CID 110048963) has the molecular formula C17H33N5O4 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl (4S)-3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 110048963 |
| Molecular Formula | C17H33N5O4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | tert-butyl (4S)-3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NC1CN(C(=O)OC(C)(C)C)C[C@@H]1OC |
| InChI | InChI=1S/C17H33N5O4/c1-8-18-15(19-9-14(23)21(5)6)20-12-10-22(11-13(12)25-7)16(24)26-17(2,3)4/h12-13H,8-11H2,1-7H3,(H2,18,19,20)/t12?,13-/m0/s1 |
| InChIKey | HSNAWSJCZAGJDU-ABLWVSNPSA-N |
| XLogP | 0.26 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|