C18H34IN5O4 — CID 110048974
tert-butyl (4S)-3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate;hydroiodide (PubChem CID 110048974) has the molecular formula C18H34IN5O4 and a molecular weight of 511.41 g/mol. Its IUPAC name is tert-butyl (4S)-3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl (4S)-3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110048974 |
| Molecular Formula | C18H34IN5O4 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | tert-butyl (4S)-3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NC1CN(C(=O)OC(C)(C)C)C[C@@H]1OC.I |
| InChI | InChI=1S/C18H33N5O4.HI/c1-8-9-19-16(20-10-15(24)22(5)6)21-13-11-23(12-14(13)26-7)17(25)27-18(2,3)4;/h8,13-14H,1,9-12H2,2-7H3,(H2,19,20,21);1H/t13?,14-;/m0./s1 |
| InChIKey | ZXNJZRGMCCRVCK-IJDFPQMLSA-N |
| XLogP | 1.05 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|