C17H31N5O3 — CID 111908659
tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]pyrrolidine-1-carboxylate (PubChem CID 111908659) has the molecular formula C17H31N5O3 and a molecular weight of 353.47 g/mol. Its IUPAC name is tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 111908659 |
| Molecular Formula | C17H31N5O3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]amino]pyrrolidine-1-carboxylate |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H31N5O3/c1-7-9-18-15(19-11-14(23)21(5)6)20-13-8-10-22(12-13)16(24)25-17(2,3)4/h7,13H,1,8-12H2,2-6H3,(H2,18,19,20) |
| InChIKey | JYCMQDLJBVYJQO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|