C20H38IN5O4 — CID 110040072
tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]pyrrolidine-1-carboxylate;hydroiodide (PubChem CID 110040072) has the molecular formula C20H38IN5O4 and a molecular weight of 539.46 g/mol. Its IUPAC name is tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]pyrrolidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]pyrrolidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110040072 |
| Molecular Formula | C20H38IN5O4 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | tert-butyl 3-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]pyrrolidine-1-carboxylate;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCO1)NC1CCN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C20H37N5O4.HI/c1-20(2,3)29-19(27)25-10-9-15(14-25)23-18(22-13-17(26)24(4)5)21-12-16-8-6-7-11-28-16;/h15-16H,6-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | UNBVVZQMMDGHMG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|