C15H29IN4O4S — CID 111893738
2-[[[(1,1-dioxothiolan-3-yl)amino]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111893738) has the molecular formula C15H29IN4O4S and a molecular weight of 488.39 g/mol. Its IUPAC name is 2-[[[(1,1-dioxothiolan-3-yl)amino]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(1,1-dioxothiolan-3-yl)amino]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111893738 |
| Molecular Formula | C15H29IN4O4S |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 2-[[[(1,1-dioxothiolan-3-yl)amino]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCO1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H28N4O4S.HI/c1-19(2)14(20)10-17-15(16-9-13-5-3-4-7-23-13)18-12-6-8-24(21,22)11-12;/h12-13H,3-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | BSHJIRWHSWHHNF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|