C18H35IN6O3 — CID 110039682
N,N-dimethyl-2-[[[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110039682) has the molecular formula C18H35IN6O3 and a molecular weight of 510.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110039682 |
| Molecular Formula | C18H35IN6O3 |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | N,N-dimethyl-2-[[[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CNC(=O)CN1CCC(N/C(=N/CC(=O)N(C)C)NCC2CCCO2)CC1.I |
| InChI | InChI=1S/C18H34N6O3.HI/c1-19-16(25)13-24-8-6-14(7-9-24)22-18(21-12-17(26)23(2)3)20-11-15-5-4-10-27-15;/h14-15H,4-13H2,1-3H3,(H,19,25)(H2,20,21,22);1H |
| InChIKey | YVVBKEPKSGWZCW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|