C22H41N5O2 — CID 110048939
N,N-dimethyl-2-[[[[4-(4-methylpiperidin-1-yl)cyclohexyl]amino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide (PubChem CID 110048939) has the molecular formula C22H41N5O2 and a molecular weight of 407.60 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[[4-(4-methylpiperidin-1-yl)cyclohexyl]amino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[[4-(4-methylpiperidin-1-yl)cyclohexyl]amino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110048939 |
| Molecular Formula | C22H41N5O2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.33 |
| IUPAC Name | N,N-dimethyl-2-[[[[4-(4-methylpiperidin-1-yl)cyclohexyl]amino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide |
| SMILES | CC1CCN(C2CCC(N/C(=N/CC(=O)N(C)C)NCC3CCCO3)CC2)CC1 |
| InChI | InChI=1S/C22H41N5O2/c1-17-10-12-27(13-11-17)19-8-6-18(7-9-19)25-22(24-16-21(28)26(2)3)23-15-20-5-4-14-29-20/h17-20H,4-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | FRVOAXJRJSOHQU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|