C21H42IN5O — CID 110048914
N,N-dimethyl-2-[[[[4-(4-methylpiperidin-1-yl)cyclohexyl]amino]-(2-methylpropylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110048914) has the molecular formula C21H42IN5O and a molecular weight of 507.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[[4-(4-methylpiperidin-1-yl)cyclohexyl]amino]-(2-methylpropylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[[4-(4-methylpiperidin-1-yl)cyclohexyl]amino]-(2-methylpropylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110048914 |
| Molecular Formula | C21H42IN5O |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | N,N-dimethyl-2-[[[[4-(4-methylpiperidin-1-yl)cyclohexyl]amino]-(2-methylpropylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(C)CN/C(=N\CC(=O)N(C)C)NC1CCC(N2CCC(C)CC2)CC1.I |
| InChI | InChI=1S/C21H41N5O.HI/c1-16(2)14-22-21(23-15-20(27)25(4)5)24-18-6-8-19(9-7-18)26-12-10-17(3)11-13-26;/h16-19H,6-15H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | WNMJORLQLFIYKP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|