C22H35N5O4 — CID 110048947
tert-butyl (4S)-3-[[N'-benzyl-N-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate (PubChem CID 110048947) has the molecular formula C22H35N5O4 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl (4S)-3-[[N'-benzyl-N-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3-[[N'-benzyl-N-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 110048947 |
| Molecular Formula | C22H35N5O4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | tert-butyl (4S)-3-[[N'-benzyl-N-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CO[C@H]1CN(C(=O)OC(C)(C)C)CC1N/C(=N/Cc1ccccc1)NCC(=O)N(C)C |
| InChI | InChI=1S/C22H35N5O4/c1-22(2,3)31-21(29)27-14-17(18(15-27)30-6)25-20(24-13-19(28)26(4)5)23-12-16-10-8-7-9-11-16/h7-11,17-18H,12-15H2,1-6H3,(H2,23,24,25)/t17?,18-/m0/s1 |
| InChIKey | BSZBDBGZMULGDH-ZVAWYAOSSA-N |
| XLogP | 1.44 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|