C21H39N5O4 — CID 110048965
tert-butyl (4S)-3-[[N-cyclohexyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate (PubChem CID 110048965) has the molecular formula C21H39N5O4 and a molecular weight of 425.57 g/mol. Its IUPAC name is tert-butyl (4S)-3-[[N-cyclohexyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3-[[N-cyclohexyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 110048965 |
| Molecular Formula | C21H39N5O4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | tert-butyl (4S)-3-[[N-cyclohexyl-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CO[C@H]1CN(C(=O)OC(C)(C)C)CC1N/C(=N/CC(=O)N(C)C)NC1CCCCC1 |
| InChI | InChI=1S/C21H39N5O4/c1-21(2,3)30-20(28)26-13-16(17(14-26)29-6)24-19(22-12-18(27)25(4)5)23-15-10-8-7-9-11-15/h15-17H,7-14H2,1-6H3,(H2,22,23,24)/t16?,17-/m0/s1 |
| InChIKey | IUOXCNZDIPUJMJ-DJNXLDHESA-N |
| XLogP | 1.58 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|