C17H31N5O — CID 110041878
N,N-dimethyl-2-[[(prop-2-enylamino)-[3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methylidene]amino]acetamide (PubChem CID 110041878) has the molecular formula C17H31N5O and a molecular weight of 321.47 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(prop-2-enylamino)-[3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(prop-2-enylamino)-[3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110041878 |
| Molecular Formula | C17H31N5O |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | N,N-dimethyl-2-[[(prop-2-enylamino)-[3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methylidene]amino]acetamide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N1CCC(CN2CCCC2)C1 |
| InChI | InChI=1S/C17H31N5O/c1-4-8-18-17(19-12-16(23)20(2)3)22-11-7-15(14-22)13-21-9-5-6-10-21/h4,15H,1,5-14H2,2-3H3,(H,18,19) |
| InChIKey | XRZOZJNZCUSFQO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|