C15H28IN5O2 — CID 110044500
2-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]piperidin-3-yl]acetamide;hydroiodide (PubChem CID 110044500) has the molecular formula C15H28IN5O2 and a molecular weight of 437.33 g/mol. Its IUPAC name is 2-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]piperidin-3-yl]acetamide;hydroiodide.
| Compound Name | 2-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]piperidin-3-yl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110044500 |
| Molecular Formula | C15H28IN5O2 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]piperidin-3-yl]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N1CCCC(CC(N)=O)C1.I |
| InChI | InChI=1S/C15H27N5O2.HI/c1-4-7-17-15(18-10-14(22)19(2)3)20-8-5-6-12(11-20)9-13(16)21;/h4,12H,1,5-11H2,2-3H3,(H2,16,21)(H,17,18);1H |
| InChIKey | DVQGGIVCQINIGX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|