C20H39N5O2 — CID 110044463
2-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-ethylhexyl)carbamimidoyl]piperidin-3-yl]acetamide (PubChem CID 110044463) has the molecular formula C20H39N5O2 and a molecular weight of 381.57 g/mol. Its IUPAC name is 2-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-ethylhexyl)carbamimidoyl]piperidin-3-yl]acetamide.
| Compound Name | 2-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-ethylhexyl)carbamimidoyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 110044463 |
| Molecular Formula | C20H39N5O2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.31 |
| IUPAC Name | 2-[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-ethylhexyl)carbamimidoyl]piperidin-3-yl]acetamide |
| SMILES | CCCCC(CC)CN/C(=N\CC(=O)N(C)C)N1CCCC(CC(N)=O)C1 |
| InChI | InChI=1S/C20H39N5O2/c1-5-7-9-16(6-2)13-22-20(23-14-19(27)24(3)4)25-11-8-10-17(15-25)12-18(21)26/h16-17H,5-15H2,1-4H3,(H2,21,26)(H,22,23) |
| InChIKey | XMRYEJHRYULKGL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|