C19H36IN5O2 — CID 110044496
2-[1-[N-(cyclohexylmethyl)-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]piperidin-3-yl]acetamide;hydroiodide (PubChem CID 110044496) has the molecular formula C19H36IN5O2 and a molecular weight of 493.43 g/mol. Its IUPAC name is 2-[1-[N-(cyclohexylmethyl)-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]piperidin-3-yl]acetamide;hydroiodide.
| Compound Name | 2-[1-[N-(cyclohexylmethyl)-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]piperidin-3-yl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110044496 |
| Molecular Formula | C19H36IN5O2 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 2-[1-[N-(cyclohexylmethyl)-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]piperidin-3-yl]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCC1)N1CCCC(CC(N)=O)C1.I |
| InChI | InChI=1S/C19H35N5O2.HI/c1-23(2)18(26)13-22-19(21-12-15-7-4-3-5-8-15)24-10-6-9-16(14-24)11-17(20)25;/h15-16H,3-14H2,1-2H3,(H2,20,25)(H,21,22);1H |
| InChIKey | GECVRKIBKIPIPA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|