C23H43IN6O2 — CID 110038560
2-[[(cyclohexylmethylamino)-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110038560) has the molecular formula C23H43IN6O2 and a molecular weight of 562.54 g/mol. Its IUPAC name is 2-[[(cyclohexylmethylamino)-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclohexylmethylamino)-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110038560 |
| Molecular Formula | C23H43IN6O2 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 2-[[(cyclohexylmethylamino)-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCC1)N1CCN(CC(=O)N2CCCCC2)CC1.I |
| InChI | InChI=1S/C23H42N6O2.HI/c1-26(2)21(30)18-25-23(24-17-20-9-5-3-6-10-20)29-15-13-27(14-16-29)19-22(31)28-11-7-4-8-12-28;/h20H,3-19H2,1-2H3,(H,24,25);1H |
| InChIKey | MEKQYJFPOCSWEA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|