C19H36N6O2 — CID 111419673
2-[[[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111419673) has the molecular formula C19H36N6O2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-[[[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111419673 |
| Molecular Formula | C19H36N6O2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 2-[[[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)N1CCN(CC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C19H36N6O2/c1-4-20-19(21-15-17(26)22(2)3)25-13-11-23(12-14-25)16-18(27)24-9-7-5-6-8-10-24/h4-16H2,1-3H3,(H,20,21) |
| InChIKey | DWFJPFBDTAOXMR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|