C15H28IN5O3 — CID 111162997
ethyl 4-[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111162997) has the molecular formula C15H28IN5O3 and a molecular weight of 453.33 g/mol. Its IUPAC name is ethyl 4-[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111162997 |
| Molecular Formula | C15H28IN5O3 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | ethyl 4-[N'-[2-(dimethylamino)-2-oxoethyl]-N-prop-2-enylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C15H27N5O3.HI/c1-5-7-16-14(17-12-13(21)18(3)4)19-8-10-20(11-9-19)15(22)23-6-2;/h5H,1,6-12H2,2-4H3,(H,16,17);1H |
| InChIKey | ZVRAZJSWTVTYGU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|