C16H28IN7OS — CID 110044188
2-[[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110044188) has the molecular formula C16H28IN7OS and a molecular weight of 493.42 g/mol. Its IUPAC name is 2-[[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110044188 |
| Molecular Formula | C16H28IN7OS |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 2-[[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N1CCN(c2nc(CC)ns2)CC1.I |
| InChI | InChI=1S/C16H27N7OS.HI/c1-5-7-17-15(18-12-14(24)21(3)4)22-8-10-23(11-9-22)16-19-13(6-2)20-25-16;/h5H,1,6-12H2,2-4H3,(H,17,18);1H |
| InChIKey | YQNCLFNBBFIYKY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|