C19H28ClIN4OS — CID 110048640
2-[[[4-(4-chlorophenyl)sulfanylpiperidin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110048640) has the molecular formula C19H28ClIN4OS and a molecular weight of 522.88 g/mol. Its IUPAC name is 2-[[[4-(4-chlorophenyl)sulfanylpiperidin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-(4-chlorophenyl)sulfanylpiperidin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110048640 |
| Molecular Formula | C19H28ClIN4OS |
| Molecular Weight | 522.88 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 2-[[[4-(4-chlorophenyl)sulfanylpiperidin-1-yl]-(prop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N1CCC(Sc2ccc(Cl)cc2)CC1.I |
| InChI | InChI=1S/C19H27ClN4OS.HI/c1-4-11-21-19(22-14-18(25)23(2)3)24-12-9-17(10-13-24)26-16-7-5-15(20)6-8-16;/h4-8,17H,1,9-14H2,2-3H3,(H,21,22);1H |
| InChIKey | JRJLZECCXGOWCX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|