C21H35ClIN5O2 — CID 111325611
2-[[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-(3-ethoxypropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111325611) has the molecular formula C21H35ClIN5O2 and a molecular weight of 551.90 g/mol. Its IUPAC name is 2-[[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-(3-ethoxypropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-(3-ethoxypropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111325611 |
| Molecular Formula | C21H35ClIN5O2 |
| Molecular Weight | 551.90 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 2-[[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-(3-ethoxypropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)N1CCN(Cc2ccc(Cl)cc2)CC1.I |
| InChI | InChI=1S/C21H34ClN5O2.HI/c1-4-29-15-5-10-23-21(24-16-20(28)25(2)3)27-13-11-26(12-14-27)17-18-6-8-19(22)9-7-18;/h6-9H,4-5,10-17H2,1-3H3,(H,23,24);1H |
| InChIKey | IXBOKAHDXJHKDD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.90 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|