C15H31IN4O2 — CID 111421538
2-[[(3-ethoxypropylamino)-piperidin-1-ylmethylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111421538) has the molecular formula C15H31IN4O2 and a molecular weight of 426.34 g/mol. Its IUPAC name is 2-[[(3-ethoxypropylamino)-piperidin-1-ylmethylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3-ethoxypropylamino)-piperidin-1-ylmethylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111421538 |
| Molecular Formula | C15H31IN4O2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 2-[[(3-ethoxypropylamino)-piperidin-1-ylmethylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)N1CCCCC1.I |
| InChI | InChI=1S/C15H30N4O2.HI/c1-4-21-12-8-9-16-15(17-13-14(20)18(2)3)19-10-6-5-7-11-19;/h4-13H2,1-3H3,(H,16,17);1H |
| InChIKey | DTDCGIDOHHFSPZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|