C18H32IN7O3 — CID 110042892
2-[[(3-ethoxypropylamino)-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110042892) has the molecular formula C18H32IN7O3 and a molecular weight of 521.40 g/mol. Its IUPAC name is 2-[[(3-ethoxypropylamino)-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3-ethoxypropylamino)-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110042892 |
| Molecular Formula | C18H32IN7O3 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 2-[[(3-ethoxypropylamino)-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C18H31N7O3.HI/c1-5-28-10-6-7-19-18(20-12-16(26)22(2)3)24-8-9-25(17(27)14-24)15-11-21-23(4)13-15;/h11,13H,5-10,12,14H2,1-4H3,(H,19,20);1H |
| InChIKey | PCZVTNIKAOPEHV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|