C15H23F3N6O2 — CID 109432823
N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboximidamide (PubChem CID 109432823) has the molecular formula C15H23F3N6O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109432823 |
| Molecular Formula | C15H23F3N6O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C15H23F3N6O2/c1-19-14(20-4-3-7-26-11-15(16,17)18)23-5-6-24(13(25)10-23)12-8-21-22(2)9-12/h8-9H,3-7,10-11H2,1-2H3,(H,19,20) |
| InChIKey | DFGUATCCYMRVOG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|