C19H30F3N7O — CID 109433139
N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperazine-1-carboximidamide (PubChem CID 109433139) has the molecular formula C19H30F3N7O and a molecular weight of 429.49 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433139 |
| Molecular Formula | C19H30F3N7O |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCC1CCN(CC(F)(F)F)CC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C19H30F3N7O/c1-23-18(24-6-3-15-4-7-27(8-5-15)14-19(20,21)22)28-9-10-29(17(30)13-28)16-11-25-26(2)12-16/h11-12,15H,3-10,13-14H2,1-2H3,(H,23,24) |
| InChIKey | HEXNFBMJCPXHQJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|