C16H28IN7O3S — CID 109436398
N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109436398) has the molecular formula C16H28IN7O3S and a molecular weight of 525.42 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109436398 |
| Molecular Formula | C16H28IN7O3S |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCN1CCS(=O)(=O)CC1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C16H27N7O3S.HI/c1-17-16(18-3-4-21-7-9-27(25,26)10-8-21)22-5-6-23(15(24)13-22)14-11-19-20(2)12-14;/h11-12H,3-10,13H2,1-2H3,(H,17,18);1H |
| InChIKey | PCNJTYNELFMCRW-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|