C14H24N6OS — CID 109435417
N'-methyl-4-(1-methylpyrazol-4-yl)-N-(3-methylsulfanylpropyl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109435417) has the molecular formula C14H24N6OS and a molecular weight of 324.45 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-N-(3-methylsulfanylpropyl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-(3-methylsulfanylpropyl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435417 |
| Molecular Formula | C14H24N6OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-(3-methylsulfanylpropyl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCSC)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C14H24N6OS/c1-15-14(16-5-4-8-22-3)19-6-7-20(13(21)11-19)12-9-17-18(2)10-12/h9-10H,4-8,11H2,1-3H3,(H,15,16) |
| InChIKey | CNJBHQCWGPMGMH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|