C16H25N9O — CID 109435905
N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide (PubChem CID 109435905) has the molecular formula C16H25N9O and a molecular weight of 359.44 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435905 |
| Molecular Formula | C16H25N9O |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCn1cnnc1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C16H25N9O/c1-17-16(18-5-3-4-6-23-12-19-20-13-23)24-7-8-25(15(26)11-24)14-9-21-22(2)10-14/h9-10,12-13H,3-8,11H2,1-2H3,(H,17,18) |
| InChIKey | CNEZJENKIYVXHU-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|