C19H34N8O — CID 109436461
N'-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109436461) has the molecular formula C19H34N8O and a molecular weight of 390.54 g/mol. Its IUPAC name is N'-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436461 |
| Molecular Formula | C19H34N8O |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | N'-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCN1CCN(C)CC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C19H34N8O/c1-20-19(21-6-4-5-7-25-10-8-23(2)9-11-25)26-12-13-27(18(28)16-26)17-14-22-24(3)15-17/h14-15H,4-13,16H2,1-3H3,(H,20,21) |
| InChIKey | TXKXPZDOJQCNDV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|