C19H35N7O — CID 109433229
N-[3-(dipropylamino)propyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109433229) has the molecular formula C19H35N7O and a molecular weight of 377.54 g/mol. Its IUPAC name is N-[3-(dipropylamino)propyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[3-(dipropylamino)propyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433229 |
| Molecular Formula | C19H35N7O |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | N-[3-(dipropylamino)propyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCCN(CCC)CCCN/C(=N\C)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C19H35N7O/c1-5-9-24(10-6-2)11-7-8-21-19(20-3)25-12-13-26(18(27)16-25)17-14-22-23(4)15-17/h14-15H,5-13,16H2,1-4H3,(H,20,21) |
| InChIKey | HKEZVOHGWPCBQY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|